C27H30N2O7 — CID 172850916
5-(2-methoxyethoxycarbonyl)-2,6-dimethyl-4-(4-nitrophenyl)-3-[(E)-3-phenylprop-2-enyl]-2,4-dihydro-1H-pyridine-3-carboxylic acid (PubChem CID 172850916) has the molecular formula C27H30N2O7 and a molecular weight of 494.54 g/mol. Its IUPAC name is 5-(2-methoxyethoxycarbonyl)-2,6-dimethyl-4-(4-nitrophenyl)-3-[(E)-3-phenylprop-2-enyl]-2,4-dihydro-1H-pyridine-3-carboxylic acid.
| Compound Name | 5-(2-methoxyethoxycarbonyl)-2,6-dimethyl-4-(4-nitrophenyl)-3-[(E)-3-phenylprop-2-enyl]-2,4-dihydro-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 172850916 |
| Molecular Formula | C27H30N2O7 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | 5-(2-methoxyethoxycarbonyl)-2,6-dimethyl-4-(4-nitrophenyl)-3-[(E)-3-phenylprop-2-enyl]-2,4-dihydro-1H-pyridine-3-carboxylic acid |
| SMILES | COCCOC(=O)C1=C(C)NC(C)C(C/C=C/c2ccccc2)(C(=O)O)C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H30N2O7/c1-18-23(25(30)36-17-16-35-3)24(21-11-13-22(14-12-21)29(33)34)27(26(31)32,19(2)28-18)15-7-10-20-8-5-4-6-9-20/h4-14,19,24,28H,15-17H2,1-3H3,(H,31,32)/b10-7+ |
| InChIKey | YBCKFCSPQKSJQT-JXMROGBWSA-N |
| XLogP | 4.31 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|