C24H18F3N3O3 — CID 17285222
N-[(E)-1-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]-9H-xanthene-9-carboxamide (PubChem CID 17285222) has the molecular formula C24H18F3N3O3 and a molecular weight of 453.42 g/mol. Its IUPAC name is N-[(E)-1-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]-9H-xanthene-9-carboxamide.
| Compound Name | N-[(E)-1-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 17285222 |
| Molecular Formula | C24H18F3N3O3 |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | N-[(E)-1-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]-9H-xanthene-9-carboxamide |
| SMILES | C/C(=N\NC(=O)C1c2ccccc2Oc2ccccc21)c1cccc(NC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C24H18F3N3O3/c1-14(15-7-6-8-16(13-15)28-23(32)24(25,26)27)29-30-22(31)21-17-9-2-4-11-19(17)33-20-12-5-3-10-18(20)21/h2-13,21H,1H3,(H,28,32)(H,30,31)/b29-14+ |
| InChIKey | UWMFUGPTUZPSMN-IPPBACCNSA-N |
| XLogP | 4.97 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|