C28H23N3O4S — CID 997750
N-[1-[3-(benzenesulfonamido)phenyl]ethylideneamino]-9H-xanthene-9-carboxamide (PubChem CID 997750) has the molecular formula C28H23N3O4S and a molecular weight of 497.58 g/mol. Its IUPAC name is N-[1-[3-(benzenesulfonamido)phenyl]ethylideneamino]-9H-xanthene-9-carboxamide.
| Compound Name | N-[1-[3-(benzenesulfonamido)phenyl]ethylideneamino]-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 997750 |
| Molecular Formula | C28H23N3O4S |
| Molecular Weight | 497.58 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | N-[1-[3-(benzenesulfonamido)phenyl]ethylideneamino]-9H-xanthene-9-carboxamide |
| SMILES | CC(=NNC(=O)C1c2ccccc2Oc2ccccc21)c1cccc(NS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C28H23N3O4S/c1-19(20-10-9-11-21(18-20)31-36(33,34)22-12-3-2-4-13-22)29-30-28(32)27-23-14-5-7-16-25(23)35-26-17-8-6-15-24(26)27/h2-18,27,31H,1H3,(H,30,32) |
| InChIKey | ACFNQNGIJTWXSY-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.58 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|