C10H12N2O2S — CID 172854728
3-(pyridin-3-ylmethyl)-1,3-thiazolidine-2-carboxylic acid (PubChem CID 172854728) has the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. Its IUPAC name is 3-(pyridin-3-ylmethyl)-1,3-thiazolidine-2-carboxylic acid.
| Compound Name | 3-(pyridin-3-ylmethyl)-1,3-thiazolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 172854728 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 3-(pyridin-3-ylmethyl)-1,3-thiazolidine-2-carboxylic acid |
| SMILES | O=C(O)C1SCCN1Cc1cccnc1 |
| InChI | InChI=1S/C10H12N2O2S/c13-10(14)9-12(4-5-15-9)7-8-2-1-3-11-6-8/h1-3,6,9H,4-5,7H2,(H,13,14) |
| InChIKey | YNTAXBCCTPYETM-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |