C15H13N5O3 — CID 172855459
N-(2,4-dimethoxypyrimidin-5-yl)cinnoline-3-carboxamide (PubChem CID 172855459) has the molecular formula C15H13N5O3 and a molecular weight of 311.30 g/mol. Its IUPAC name is N-(2,4-dimethoxypyrimidin-5-yl)cinnoline-3-carboxamide.
| Compound Name | N-(2,4-dimethoxypyrimidin-5-yl)cinnoline-3-carboxamide |
|---|---|
| PubChem CID | 172855459 |
| Molecular Formula | C15H13N5O3 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | N-(2,4-dimethoxypyrimidin-5-yl)cinnoline-3-carboxamide |
| SMILES | COc1ncc(NC(=O)c2cc3ccccc3nn2)c(OC)n1 |
| InChI | InChI=1S/C15H13N5O3/c1-22-14-12(8-16-15(18-14)23-2)17-13(21)11-7-9-5-3-4-6-10(9)19-20-11/h3-8H,1-2H3,(H,17,21) |
| InChIKey | YQHYREUPBFFNMU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |