C11H10BrN3O3S — CID 122304110
4-bromo-N-(2,4-dimethoxypyrimidin-5-yl)thiophene-2-carboxamide (PubChem CID 122304110) has the molecular formula C11H10BrN3O3S and a molecular weight of 344.19 g/mol. Its IUPAC name is 4-bromo-N-(2,4-dimethoxypyrimidin-5-yl)thiophene-2-carboxamide.
| Compound Name | 4-bromo-N-(2,4-dimethoxypyrimidin-5-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 122304110 |
| Molecular Formula | C11H10BrN3O3S |
| Molecular Weight | 344.19 g/mol |
| Exact Mass | 342.96 |
| IUPAC Name | 4-bromo-N-(2,4-dimethoxypyrimidin-5-yl)thiophene-2-carboxamide |
| SMILES | COc1ncc(NC(=O)c2cc(Br)cs2)c(OC)n1 |
| InChI | InChI=1S/C11H10BrN3O3S/c1-17-10-7(4-13-11(15-10)18-2)14-9(16)8-3-6(12)5-19-8/h3-5H,1-2H3,(H,14,16) |
| InChIKey | FHHJTGBKTUXFCV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.19 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |