C21H24ClNO4 — CID 17285585
2-propoxyethyl 6-(2-chlorophenyl)-3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carboxylate (PubChem CID 17285585) has the molecular formula C21H24ClNO4 and a molecular weight of 389.88 g/mol. Its IUPAC name is 2-propoxyethyl 6-(2-chlorophenyl)-3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carboxylate.
| Compound Name | 2-propoxyethyl 6-(2-chlorophenyl)-3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 17285585 |
| Molecular Formula | C21H24ClNO4 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 2-propoxyethyl 6-(2-chlorophenyl)-3-methyl-4-oxo-1,5,6,7-tetrahydroindole-2-carboxylate |
| SMILES | CCCOCCOC(=O)c1[nH]c2c(c1C)C(=O)CC(c1ccccc1Cl)C2 |
| InChI | InChI=1S/C21H24ClNO4/c1-3-8-26-9-10-27-21(25)20-13(2)19-17(23-20)11-14(12-18(19)24)15-6-4-5-7-16(15)22/h4-7,14,23H,3,8-12H2,1-2H3 |
| InChIKey | MBICFQYDFRABMI-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|