C25H39FN7O5P — CID 172857037
[4-[[4-(cycloheptylamino)-6-(3-fluoro-4-methoxyanilino)-1,3,5-triazin-2-yl]-methylamino]-1-methylpiperidin-1-ium-1-yl]methyl hydrogen phosphate (PubChem CID 172857037) has the molecular formula C25H39FN7O5P and a molecular weight of 567.60 g/mol. Its IUPAC name is [4-[[4-(cycloheptylamino)-6-(3-fluoro-4-methoxyanilino)-1,3,5-triazin-2-yl]-methylamino]-1-methylpiperidin-1-ium-1-yl]methyl hydrogen phosphate.
| Compound Name | [4-[[4-(cycloheptylamino)-6-(3-fluoro-4-methoxyanilino)-1,3,5-triazin-2-yl]-methylamino]-1-methylpiperidin-1-ium-1-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 172857037 |
| Molecular Formula | C25H39FN7O5P |
| Molecular Weight | 567.60 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | [4-[[4-(cycloheptylamino)-6-(3-fluoro-4-methoxyanilino)-1,3,5-triazin-2-yl]-methylamino]-1-methylpiperidin-1-ium-1-yl]methyl hydrogen phosphate |
| SMILES | COc1ccc(Nc2nc(NC3CCCCCC3)nc(N(C)C3CC[N+](C)(COP(=O)([O-])O)CC3)n2)cc1F |
| InChI | InChI=1S/C25H39FN7O5P/c1-32(20-12-14-33(2,15-13-20)17-38-39(34,35)36)25-30-23(27-18-8-6-4-5-7-9-18)29-24(31-25)28-19-10-11-22(37-3)21(26)16-19/h10-11,16,18,20H,4-9,12-15,17H2,1-3H3,(H3-,27,28,29,30,31,34,35,36) |
| InChIKey | YVPDBDTWWMDXEH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 144.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.60 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|