C25H39FIN7O — CID 69485022
2-N-cycloheptyl-6-N-[(1-ethyl-1-methylpyrrolidin-1-ium-2-yl)methyl]-4-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine iodide (PubChem CID 69485022) has the molecular formula C25H39FIN7O and a molecular weight of 599.54 g/mol. Its IUPAC name is 2-N-cycloheptyl-6-N-[(1-ethyl-1-methylpyrrolidin-1-ium-2-yl)methyl]-4-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine iodide.
| Compound Name | 2-N-cycloheptyl-6-N-[(1-ethyl-1-methylpyrrolidin-1-ium-2-yl)methyl]-4-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine iodide |
|---|---|
| PubChem CID | 69485022 |
| Molecular Formula | C25H39FIN7O |
| Molecular Weight | 599.54 g/mol |
| Exact Mass | 599.22 |
| IUPAC Name | 2-N-cycloheptyl-6-N-[(1-ethyl-1-methylpyrrolidin-1-ium-2-yl)methyl]-4-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine iodide |
| SMILES | CC[N+]1(C)CCCC1CNc1nc(Nc2ccc(OC)c(F)c2)nc(NC2CCCCCC2)n1.[I-] |
| InChI | InChI=1S/C25H39FN7O.HI/c1-4-33(2)15-9-12-20(33)17-27-23-30-24(28-18-10-7-5-6-8-11-18)32-25(31-23)29-19-13-14-22(34-3)21(26)16-19;/h13-14,16,18,20H,4-12,15,17H2,1-3H3,(H3,27,28,29,30,31,32);1H/q+1;/p-1 |
| InChIKey | QSDIYQLLJVLNAE-UHFFFAOYSA-M |
| XLogP | 1.94 |
| TPSA | 83.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.54 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|