C16H10ClNO3 — CID 172859196
3-chloro-2-[(1,3-dioxoisoindol-2-yl)methyl]benzaldehyde (PubChem CID 172859196) has the molecular formula C16H10ClNO3 and a molecular weight of 299.71 g/mol. Its IUPAC name is 3-chloro-2-[(1,3-dioxoisoindol-2-yl)methyl]benzaldehyde.
| Compound Name | 3-chloro-2-[(1,3-dioxoisoindol-2-yl)methyl]benzaldehyde |
|---|---|
| PubChem CID | 172859196 |
| Molecular Formula | C16H10ClNO3 |
| Molecular Weight | 299.71 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 3-chloro-2-[(1,3-dioxoisoindol-2-yl)methyl]benzaldehyde |
| SMILES | O=Cc1cccc(Cl)c1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H10ClNO3/c17-14-7-3-4-10(9-19)13(14)8-18-15(20)11-5-1-2-6-12(11)16(18)21/h1-7,9H,8H2 |
| InChIKey | ZCWVRASFHUVHSJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.71 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|