C18H26FNO3 — CID 172862137
tert-butyl 5-(3-fluorophenyl)-3-hydroxy-2-propan-2-ylpyrrolidine-1-carboxylate (PubChem CID 172862137) has the molecular formula C18H26FNO3 and a molecular weight of 323.41 g/mol. Its IUPAC name is tert-butyl 5-(3-fluorophenyl)-3-hydroxy-2-propan-2-ylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 5-(3-fluorophenyl)-3-hydroxy-2-propan-2-ylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 172862137 |
| Molecular Formula | C18H26FNO3 |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | tert-butyl 5-(3-fluorophenyl)-3-hydroxy-2-propan-2-ylpyrrolidine-1-carboxylate |
| SMILES | CC(C)C1C(O)CC(c2cccc(F)c2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H26FNO3/c1-11(2)16-15(21)10-14(12-7-6-8-13(19)9-12)20(16)17(22)23-18(3,4)5/h6-9,11,14-16,21H,10H2,1-5H3 |
| InChIKey | ZMMOPGAMSUJHGU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |