C10H11N3O2S — CID 172868617
1-(1,1-dioxothietan-3-yl)benzimidazol-5-amine (PubChem CID 172868617) has the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. Its IUPAC name is 1-(1,1-dioxothietan-3-yl)benzimidazol-5-amine.
| Compound Name | 1-(1,1-dioxothietan-3-yl)benzimidazol-5-amine |
|---|---|
| PubChem CID | 172868617 |
| Molecular Formula | C10H11N3O2S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 1-(1,1-dioxothietan-3-yl)benzimidazol-5-amine |
| SMILES | Nc1ccc2c(c1)ncn2C1CS(=O)(=O)C1 |
| InChI | InChI=1S/C10H11N3O2S/c11-7-1-2-10-9(3-7)12-6-13(10)8-4-16(14,15)5-8/h1-3,6,8H,4-5,11H2 |
| InChIKey | OVDRKMHUCYTUHT-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|