C34H30N4O8 — CID 172874280
[(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-5-cyano-3,4-bis[(2-phenylacetyl)oxy]oxolan-2-yl]methyl 2-phenylacetate (PubChem CID 172874280) has the molecular formula C34H30N4O8 and a molecular weight of 622.63 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-5-cyano-3,4-bis[(2-phenylacetyl)oxy]oxolan-2-yl]methyl 2-phenylacetate.
| Compound Name | [(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-5-cyano-3,4-bis[(2-phenylacetyl)oxy]oxolan-2-yl]methyl 2-phenylacetate |
|---|---|
| PubChem CID | 172874280 |
| Molecular Formula | C34H30N4O8 |
| Molecular Weight | 622.63 g/mol |
| Exact Mass | 622.21 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-5-cyano-3,4-bis[(2-phenylacetyl)oxy]oxolan-2-yl]methyl 2-phenylacetate |
| SMILES | N#C[C@@]1(n2ccc(N)nc2=O)O[C@H](COC(=O)Cc2ccccc2)[C@@H](OC(=O)Cc2ccccc2)[C@H]1OC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C34H30N4O8/c35-22-34(38-17-16-27(36)37-33(38)42)32(45-30(41)20-25-14-8-3-9-15-25)31(44-29(40)19-24-12-6-2-7-13-24)26(46-34)21-43-28(39)18-23-10-4-1-5-11-23/h1-17,26,31-32H,18-21H2,(H2,36,37,42)/t26-,31-,32-,34-/m1/s1 |
| InChIKey | OCSLNBSMIZSBAQ-NWDHONGASA-N |
| XLogP | 2.50 |
| TPSA | 172.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.63 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|