C30H27NO7 — CID 175910037
[5-cyano-3,4-bis[(2-phenylacetyl)oxy]oxolan-2-yl]methyl 2-phenylacetate (PubChem CID 175910037) has the molecular formula C30H27NO7 and a molecular weight of 513.55 g/mol. Its IUPAC name is [5-cyano-3,4-bis[(2-phenylacetyl)oxy]oxolan-2-yl]methyl 2-phenylacetate.
| Compound Name | [5-cyano-3,4-bis[(2-phenylacetyl)oxy]oxolan-2-yl]methyl 2-phenylacetate |
|---|---|
| PubChem CID | 175910037 |
| Molecular Formula | C30H27NO7 |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | [5-cyano-3,4-bis[(2-phenylacetyl)oxy]oxolan-2-yl]methyl 2-phenylacetate |
| SMILES | N#CC1OC(COC(=O)Cc2ccccc2)C(OC(=O)Cc2ccccc2)C1OC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C30H27NO7/c31-19-24-29(37-27(33)17-22-12-6-2-7-13-22)30(38-28(34)18-23-14-8-3-9-15-23)25(36-24)20-35-26(32)16-21-10-4-1-5-11-21/h1-15,24-25,29-30H,16-18,20H2 |
| InChIKey | KYWZONNUEQJDDY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 111.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|