C24H26N4O6S — CID 172877397
(2Z)-7-methyl-6-(methylperoxymethyl)-5-phenyl-2-[(3,4,5-trimethoxyphenyl)hydrazinylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-one (PubChem CID 172877397) has the molecular formula C24H26N4O6S and a molecular weight of 498.56 g/mol. Its IUPAC name is (2Z)-7-methyl-6-(methylperoxymethyl)-5-phenyl-2-[(3,4,5-trimethoxyphenyl)hydrazinylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-one.
| Compound Name | (2Z)-7-methyl-6-(methylperoxymethyl)-5-phenyl-2-[(3,4,5-trimethoxyphenyl)hydrazinylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-one |
|---|---|
| PubChem CID | 172877397 |
| Molecular Formula | C24H26N4O6S |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | (2Z)-7-methyl-6-(methylperoxymethyl)-5-phenyl-2-[(3,4,5-trimethoxyphenyl)hydrazinylidene]-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-one |
| SMILES | COOCC1=C(C)N=C2S/C(=N\Nc3cc(OC)c(OC)c(OC)c3)C(=O)N2C1c1ccccc1 |
| InChI | InChI=1S/C24H26N4O6S/c1-14-17(13-34-33-5)20(15-9-7-6-8-10-15)28-23(29)22(35-24(28)25-14)27-26-16-11-18(30-2)21(32-4)19(12-16)31-3/h6-12,20,26H,13H2,1-5H3/b27-22- |
| InChIKey | UZHXZRHKBVMKTJ-QYQHSDTDSA-N |
| XLogP | 3.98 |
| TPSA | 103.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|