C36H28N4S — CID 172878754
4-[4-[3,7-bis(4-aminophenyl)phenothiazin-10-yl]phenyl]aniline (PubChem CID 172878754) has the molecular formula C36H28N4S and a molecular weight of 548.72 g/mol. Its IUPAC name is 4-[4-[3,7-bis(4-aminophenyl)phenothiazin-10-yl]phenyl]aniline.
| Compound Name | 4-[4-[3,7-bis(4-aminophenyl)phenothiazin-10-yl]phenyl]aniline |
|---|---|
| PubChem CID | 172878754 |
| Molecular Formula | C36H28N4S |
| Molecular Weight | 548.72 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | 4-[4-[3,7-bis(4-aminophenyl)phenothiazin-10-yl]phenyl]aniline |
| SMILES | Nc1ccc(-c2ccc(N3c4ccc(-c5ccc(N)cc5)cc4Sc4cc(-c5ccc(N)cc5)ccc43)cc2)cc1 |
| InChI | InChI=1S/C36H28N4S/c37-29-11-1-23(2-12-29)24-7-17-32(18-8-24)40-33-19-9-27(25-3-13-30(38)14-4-25)21-35(33)41-36-22-28(10-20-34(36)40)26-5-15-31(39)16-6-26/h1-22H,37-39H2 |
| InChIKey | YDQOVCZKUNGUEQ-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.72 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|