C59H45N5S — CID 144768210
7-(4,6-diphenyl-1,3,5-triazin-2-yl)-10-phenyl-N,N-bis(4-phenylphenyl)phenothiazin-3-amine;ethane (PubChem CID 144768210) has the molecular formula C59H45N5S and a molecular weight of 856.11 g/mol. Its IUPAC name is 7-(4,6-diphenyl-1,3,5-triazin-2-yl)-10-phenyl-N,N-bis(4-phenylphenyl)phenothiazin-3-amine;ethane.
| Compound Name | 7-(4,6-diphenyl-1,3,5-triazin-2-yl)-10-phenyl-N,N-bis(4-phenylphenyl)phenothiazin-3-amine;ethane |
|---|---|
| PubChem CID | 144768210 |
| Molecular Formula | C59H45N5S |
| Molecular Weight | 856.11 g/mol |
| Exact Mass | 855.34 |
| IUPAC Name | 7-(4,6-diphenyl-1,3,5-triazin-2-yl)-10-phenyl-N,N-bis(4-phenylphenyl)phenothiazin-3-amine;ethane |
| SMILES | CC.c1ccc(-c2ccc(N(c3ccc(-c4ccccc4)cc3)c3ccc4c(c3)Sc3cc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)ccc3N4c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C57H39N5S.C2H6/c1-6-16-40(17-7-1)42-26-31-48(32-27-42)61(49-33-28-43(29-34-49)41-18-8-2-9-19-41)50-35-37-52-54(39-50)63-53-38-46(30-36-51(53)62(52)47-24-14-5-15-25-47)57-59-55(44-20-10-3-11-21-44)58-56(60-57)45-22-12-4-13-23-45;1-2/h1-39H;1-2H3 |
| InChIKey | AKCWTPQNDFKXFM-UHFFFAOYSA-N |
| XLogP | 16.64 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.11 |
| LogP ≤ 5 | 16.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |