C27H29ClF3N5O5S — CID 172878842
(4R)-2-[3-[(4-chlorophenyl)methyl-(2-nitrophenyl)sulfonylamino]-1-bicyclo[1.1.1]pentanyl]-5,5-dimethyl-N-(3,3,3-trifluoropropyl)-1,4-dihydroimidazole-4-carboxamide (PubChem CID 172878842) has the molecular formula C27H29ClF3N5O5S and a molecular weight of 628.07 g/mol. Its IUPAC name is (4R)-2-[3-[(4-chlorophenyl)methyl-(2-nitrophenyl)sulfonylamino]-1-bicyclo[1.1.1]pentanyl]-5,5-dimethyl-N-(3,3,3-trifluoropropyl)-1,4-dihydroimidazole-4-carboxamide.
| Compound Name | (4R)-2-[3-[(4-chlorophenyl)methyl-(2-nitrophenyl)sulfonylamino]-1-bicyclo[1.1.1]pentanyl]-5,5-dimethyl-N-(3,3,3-trifluoropropyl)-1,4-dihydroimidazole-4-carboxamide |
|---|---|
| PubChem CID | 172878842 |
| Molecular Formula | C27H29ClF3N5O5S |
| Molecular Weight | 628.07 g/mol |
| Exact Mass | 627.15 |
| IUPAC Name | (4R)-2-[3-[(4-chlorophenyl)methyl-(2-nitrophenyl)sulfonylamino]-1-bicyclo[1.1.1]pentanyl]-5,5-dimethyl-N-(3,3,3-trifluoropropyl)-1,4-dihydroimidazole-4-carboxamide |
| SMILES | CC1(C)NC(C23CC(N(Cc4ccc(Cl)cc4)S(=O)(=O)c4ccccc4[N+](=O)[O-])(C2)C3)=N[C@H]1C(=O)NCCC(F)(F)F |
| InChI | InChI=1S/C27H29ClF3N5O5S/c1-24(2)21(22(37)32-12-11-27(29,30)31)33-23(34-24)25-14-26(15-25,16-25)35(13-17-7-9-18(28)10-8-17)42(40,41)20-6-4-3-5-19(20)36(38)39/h3-10,21H,11-16H2,1-2H3,(H,32,37)(H,33,34)/t21-,25?,26?/m0/s1 |
| InChIKey | VNBCAWJXQPTWFS-PMWKKSSLSA-N |
| XLogP | 4.58 |
| TPSA | 134.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.07 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|