C25H29ClF3N5O3S — CID 172878851
(4R)-2-[3-[(4-chlorophenyl)methyl-(3H-pyrrol-2-ylsulfonyl)amino]-1-bicyclo[1.1.1]pentanyl]-5,5-dimethyl-N-(3,3,3-trifluoropropyl)-1,4-dihydroimidazole-4-carboxamide (PubChem CID 172878851) has the molecular formula C25H29ClF3N5O3S and a molecular weight of 572.05 g/mol. Its IUPAC name is (4R)-2-[3-[(4-chlorophenyl)methyl-(3H-pyrrol-2-ylsulfonyl)amino]-1-bicyclo[1.1.1]pentanyl]-5,5-dimethyl-N-(3,3,3-trifluoropropyl)-1,4-dihydroimidazole-4-carboxamide.
| Compound Name | (4R)-2-[3-[(4-chlorophenyl)methyl-(3H-pyrrol-2-ylsulfonyl)amino]-1-bicyclo[1.1.1]pentanyl]-5,5-dimethyl-N-(3,3,3-trifluoropropyl)-1,4-dihydroimidazole-4-carboxamide |
|---|---|
| PubChem CID | 172878851 |
| Molecular Formula | C25H29ClF3N5O3S |
| Molecular Weight | 572.05 g/mol |
| Exact Mass | 571.16 |
| IUPAC Name | (4R)-2-[3-[(4-chlorophenyl)methyl-(3H-pyrrol-2-ylsulfonyl)amino]-1-bicyclo[1.1.1]pentanyl]-5,5-dimethyl-N-(3,3,3-trifluoropropyl)-1,4-dihydroimidazole-4-carboxamide |
| SMILES | CC1(C)NC(C23CC(N(Cc4ccc(Cl)cc4)S(=O)(=O)C4=NC=CC4)(C2)C3)=N[C@H]1C(=O)NCCC(F)(F)F |
| InChI | InChI=1S/C25H29ClF3N5O3S/c1-22(2)19(20(35)31-11-9-25(27,28)29)32-21(33-22)23-13-24(14-23,15-23)34(12-16-5-7-17(26)8-6-16)38(36,37)18-4-3-10-30-18/h3,5-8,10,19H,4,9,11-15H2,1-2H3,(H,31,35)(H,32,33)/t19-,23?,24?/m0/s1 |
| InChIKey | WQBYLFBTSXZRKF-HLJPNSHOSA-N |
| XLogP | 3.93 |
| TPSA | 103.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.05 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |