About 7-methyl-N-(1,2-oxazol-3-yl)-1-oxoisochromene-3-carboxamide
7-methyl-N-(1,2-oxazol-3-yl)-1-oxoisochromene-3-carboxamide (PubChem CID 172882449) has the molecular formula C14H10N2O4
and a molecular weight of 270.24 g/mol. Its IUPAC name is 7-methyl-N-(1,2-oxazol-3-yl)-1-oxoisochromene-3-carboxamide.
Molecular Properties
| Compound Name | 7-methyl-N-(1,2-oxazol-3-yl)-1-oxoisochromene-3-carboxamide |
| PubChem CID | 172882449 |
| Molecular Formula | C14H10N2O4 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 7-methyl-N-(1,2-oxazol-3-yl)-1-oxoisochromene-3-carboxamide |
| SMILES | Cc1ccc2cc(C(=O)Nc3ccon3)oc(=O)c2c1 |
| InChI | InChI=1S/C14H10N2O4/c1-8-2-3-9-7-11(20-14(18)10(9)6-8)13(17)15-12-4-5-19-16-12/h2-7H,1H3,(H,15,16,17) |
| InChIKey | CRXKDMZSWSRDIJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-methyl-N-(1,2-oxazol-3-yl)-1-oxoisochromene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-N-(1,2-oxazol-3-yl)-1-oxoisochromene-3-carboxamide?
The IUPAC name of 7-methyl-N-(1,2-oxazol-3-yl)-1-oxoisochromene-3-carboxamide (CID 172882449) is 7-methyl-N-(1,2-oxazol-3-yl)-1-oxoisochromene-3-carboxamide.
What is the SMILES notation for 7-methyl-N-(1,2-oxazol-3-yl)-1-oxoisochromene-3-carboxamide?
The canonical SMILES for 7-methyl-N-(1,2-oxazol-3-yl)-1-oxoisochromene-3-carboxamide is Cc1ccc2cc(C(=O)Nc3ccon3)oc(=O)c2c1.
What is the InChIKey of 7-methyl-N-(1,2-oxazol-3-yl)-1-oxoisochromene-3-carboxamide?
The InChIKey is CRXKDMZSWSRDIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O4/c1-8-2-3-9-7-11(20-14(18)10(9)6-8)13(17)15-12-4-5-19-16-12/h2-7H,1H3,(H,15,16,17).
What are the key properties of 7-methyl-N-(1,2-oxazol-3-yl)-1-oxoisochromene-3-carboxamide?
7-methyl-N-(1,2-oxazol-3-yl)-1-oxoisochromene-3-carboxamide has a molecular weight of 270.24 g/mol, XLogP of 2.34, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-N-(1,2-oxazol-3-yl)-1-oxoisochromene-3-carboxamide is sourced from PubChem (CID 172882449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).