C18H15NO5S — CID 175651900
7-methyl-N-(4-methylsulfonylphenyl)-1-oxoisochromene-3-carboxamide (PubChem CID 175651900) has the molecular formula C18H15NO5S and a molecular weight of 357.39 g/mol. Its IUPAC name is 7-methyl-N-(4-methylsulfonylphenyl)-1-oxoisochromene-3-carboxamide.
| Compound Name | 7-methyl-N-(4-methylsulfonylphenyl)-1-oxoisochromene-3-carboxamide |
|---|---|
| PubChem CID | 175651900 |
| Molecular Formula | C18H15NO5S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 7-methyl-N-(4-methylsulfonylphenyl)-1-oxoisochromene-3-carboxamide |
| SMILES | Cc1ccc2cc(C(=O)Nc3ccc(S(C)(=O)=O)cc3)oc(=O)c2c1 |
| InChI | InChI=1S/C18H15NO5S/c1-11-3-4-12-10-16(24-18(21)15(12)9-11)17(20)19-13-5-7-14(8-6-13)25(2,22)23/h3-10H,1-2H3,(H,19,20) |
| InChIKey | TZSJAEHDSLTEKL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |