C21H26N4O3 — CID 172888337
N-[(1R,2S)-2-[4-(1,3-benzoxazol-2-yl)piperazine-1-carbonyl]cyclohexyl]prop-2-enamide (PubChem CID 172888337) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is N-[(1R,2S)-2-[4-(1,3-benzoxazol-2-yl)piperazine-1-carbonyl]cyclohexyl]prop-2-enamide.
| Compound Name | N-[(1R,2S)-2-[4-(1,3-benzoxazol-2-yl)piperazine-1-carbonyl]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 172888337 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | N-[(1R,2S)-2-[4-(1,3-benzoxazol-2-yl)piperazine-1-carbonyl]cyclohexyl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@@H]1CCCC[C@@H]1C(=O)N1CCN(c2nc3ccccc3o2)CC1 |
| InChI | InChI=1S/C21H26N4O3/c1-2-19(26)22-16-8-4-3-7-15(16)20(27)24-11-13-25(14-12-24)21-23-17-9-5-6-10-18(17)28-21/h2,5-6,9-10,15-16H,1,3-4,7-8,11-14H2,(H,22,26)/t15-,16+/m0/s1 |
| InChIKey | ZPIPCLZEYAIJEH-JKSUJKDBSA-N |
| XLogP | 2.34 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|