C20H24F2N2O3 — CID 172888533
N-[4-[2-(3,4-difluorophenyl)morpholine-4-carbonyl]cyclohexyl]prop-2-enamide (PubChem CID 172888533) has the molecular formula C20H24F2N2O3 and a molecular weight of 378.42 g/mol. Its IUPAC name is N-[4-[2-(3,4-difluorophenyl)morpholine-4-carbonyl]cyclohexyl]prop-2-enamide.
| Compound Name | N-[4-[2-(3,4-difluorophenyl)morpholine-4-carbonyl]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 172888533 |
| Molecular Formula | C20H24F2N2O3 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | N-[4-[2-(3,4-difluorophenyl)morpholine-4-carbonyl]cyclohexyl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCC(C(=O)N2CCOC(c3ccc(F)c(F)c3)C2)CC1 |
| InChI | InChI=1S/C20H24F2N2O3/c1-2-19(25)23-15-6-3-13(4-7-15)20(26)24-9-10-27-18(12-24)14-5-8-16(21)17(22)11-14/h2,5,8,11,13,15,18H,1,3-4,6-7,9-10,12H2,(H,23,25) |
| InChIKey | IHOBNPODSBDXMM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|