C20H27N3O2 — CID 172889330
2-piperidin-1-yl-N-[[(3S)-1-prop-2-enoylpyrrolidin-3-yl]methyl]benzamide (PubChem CID 172889330) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is 2-piperidin-1-yl-N-[[(3S)-1-prop-2-enoylpyrrolidin-3-yl]methyl]benzamide.
| Compound Name | 2-piperidin-1-yl-N-[[(3S)-1-prop-2-enoylpyrrolidin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 172889330 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 2-piperidin-1-yl-N-[[(3S)-1-prop-2-enoylpyrrolidin-3-yl]methyl]benzamide |
| SMILES | C=CC(=O)N1CC[C@@H](CNC(=O)c2ccccc2N2CCCCC2)C1 |
| InChI | InChI=1S/C20H27N3O2/c1-2-19(24)23-13-10-16(15-23)14-21-20(25)17-8-4-5-9-18(17)22-11-6-3-7-12-22/h2,4-5,8-9,16H,1,3,6-7,10-15H2,(H,21,25)/t16-/m0/s1 |
| InChIKey | WKNWYUGJGAIRAR-INIZCTEOSA-N |
| XLogP | 2.44 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|