C14H18N2O2 — CID 171506747
molecular hydrogen;N-[(1-prop-2-enoylazetidin-3-yl)methyl]benzamide (PubChem CID 171506747) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is molecular hydrogen;N-[(1-prop-2-enoylazetidin-3-yl)methyl]benzamide.
| Compound Name | molecular hydrogen;N-[(1-prop-2-enoylazetidin-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 171506747 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | molecular hydrogen;N-[(1-prop-2-enoylazetidin-3-yl)methyl]benzamide |
| SMILES | C=CC(=O)N1CC(CNC(=O)c2ccccc2)C1.[H][H] |
| InChI | InChI=1S/C14H16N2O2.H2/c1-2-13(17)16-9-11(10-16)8-15-14(18)12-6-4-3-5-7-12;/h2-7,11H,1,8-10H2,(H,15,18);1H |
| InChIKey | BXQYKZPTJHBMJN-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|