C16H17FN2O3 — CID 172894530
2-(5-fluoro-2-pyridinyl)-N-[(2S)-1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]acetamide (PubChem CID 172894530) has the molecular formula C16H17FN2O3 and a molecular weight of 304.32 g/mol. Its IUPAC name is 2-(5-fluoro-2-pyridinyl)-N-[(2S)-1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]acetamide.
| Compound Name | 2-(5-fluoro-2-pyridinyl)-N-[(2S)-1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 172894530 |
| Molecular Formula | C16H17FN2O3 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2-(5-fluoro-2-pyridinyl)-N-[(2S)-1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]acetamide |
| SMILES | O=C(Cc1ccc(F)cn1)N[C@H](CO)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C16H17FN2O3/c17-12-3-4-13(18-9-12)8-16(22)19-14(10-20)7-11-1-5-15(21)6-2-11/h1-6,9,14,20-21H,7-8,10H2,(H,19,22)/t14-/m0/s1 |
| InChIKey | HLDCVKPTIJWEFK-AWEZNQCLSA-N |
| XLogP | 1.19 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |