C21H19FN2O2 — CID 172899132
N-benzyl-5-(2-ethoxy-4-fluorophenyl)pyridine-2-carboxamide (PubChem CID 172899132) has the molecular formula C21H19FN2O2 and a molecular weight of 350.39 g/mol. Its IUPAC name is N-benzyl-5-(2-ethoxy-4-fluorophenyl)pyridine-2-carboxamide.
| Compound Name | N-benzyl-5-(2-ethoxy-4-fluorophenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 172899132 |
| Molecular Formula | C21H19FN2O2 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | N-benzyl-5-(2-ethoxy-4-fluorophenyl)pyridine-2-carboxamide |
| SMILES | CCOc1cc(F)ccc1-c1ccc(C(=O)NCc2ccccc2)nc1 |
| InChI | InChI=1S/C21H19FN2O2/c1-2-26-20-12-17(22)9-10-18(20)16-8-11-19(23-14-16)21(25)24-13-15-6-4-3-5-7-15/h3-12,14H,2,13H2,1H3,(H,24,25) |
| InChIKey | IGEXQABFKKRQJW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |