C19H23ClN6 — CID 172903267
3-chloro-5-[4-[[2-(dimethylamino)pyrimidin-4-yl]-methylamino]piperidin-1-yl]benzonitrile (PubChem CID 172903267) has the molecular formula C19H23ClN6 and a molecular weight of 370.89 g/mol. Its IUPAC name is 3-chloro-5-[4-[[2-(dimethylamino)pyrimidin-4-yl]-methylamino]piperidin-1-yl]benzonitrile.
| Compound Name | 3-chloro-5-[4-[[2-(dimethylamino)pyrimidin-4-yl]-methylamino]piperidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 172903267 |
| Molecular Formula | C19H23ClN6 |
| Molecular Weight | 370.89 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 3-chloro-5-[4-[[2-(dimethylamino)pyrimidin-4-yl]-methylamino]piperidin-1-yl]benzonitrile |
| SMILES | CN(C)c1nccc(N(C)C2CCN(c3cc(Cl)cc(C#N)c3)CC2)n1 |
| InChI | InChI=1S/C19H23ClN6/c1-24(2)19-22-7-4-18(23-19)25(3)16-5-8-26(9-6-16)17-11-14(13-21)10-15(20)12-17/h4,7,10-12,16H,5-6,8-9H2,1-3H3 |
| InChIKey | CVVWIFGJYPCLAP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 59.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.89 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |