C18H18N6O — CID 172903561
N-(1-quinoxalin-2-ylpiperidin-4-yl)pyrazine-2-carboxamide (PubChem CID 172903561) has the molecular formula C18H18N6O and a molecular weight of 334.38 g/mol. Its IUPAC name is N-(1-quinoxalin-2-ylpiperidin-4-yl)pyrazine-2-carboxamide.
| Compound Name | N-(1-quinoxalin-2-ylpiperidin-4-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 172903561 |
| Molecular Formula | C18H18N6O |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | N-(1-quinoxalin-2-ylpiperidin-4-yl)pyrazine-2-carboxamide |
| SMILES | O=C(NC1CCN(c2cnc3ccccc3n2)CC1)c1cnccn1 |
| InChI | InChI=1S/C18H18N6O/c25-18(16-11-19-7-8-20-16)22-13-5-9-24(10-6-13)17-12-21-14-3-1-2-4-15(14)23-17/h1-4,7-8,11-13H,5-6,9-10H2,(H,22,25) |
| InChIKey | TVKVVZWNIUJBIG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |