C15H15Cl2N5O — CID 172900971
N-[1-(3,5-dichloro-2-pyridinyl)piperidin-4-yl]pyrazine-2-carboxamide (PubChem CID 172900971) has the molecular formula C15H15Cl2N5O and a molecular weight of 352.23 g/mol. Its IUPAC name is N-[1-(3,5-dichloro-2-pyridinyl)piperidin-4-yl]pyrazine-2-carboxamide.
| Compound Name | N-[1-(3,5-dichloro-2-pyridinyl)piperidin-4-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 172900971 |
| Molecular Formula | C15H15Cl2N5O |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | N-[1-(3,5-dichloro-2-pyridinyl)piperidin-4-yl]pyrazine-2-carboxamide |
| SMILES | O=C(NC1CCN(c2ncc(Cl)cc2Cl)CC1)c1cnccn1 |
| InChI | InChI=1S/C15H15Cl2N5O/c16-10-7-12(17)14(20-8-10)22-5-1-11(2-6-22)21-15(23)13-9-18-3-4-19-13/h3-4,7-9,11H,1-2,5-6H2,(H,21,23) |
| InChIKey | HXNZZYHHLCBGDQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |