C14H16ClN5O — CID 119072365
4-chloro-N-(1-pyrazin-2-ylpiperidin-4-yl)-1H-pyrrole-2-carboxamide (PubChem CID 119072365) has the molecular formula C14H16ClN5O and a molecular weight of 305.77 g/mol. Its IUPAC name is 4-chloro-N-(1-pyrazin-2-ylpiperidin-4-yl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-chloro-N-(1-pyrazin-2-ylpiperidin-4-yl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 119072365 |
| Molecular Formula | C14H16ClN5O |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 4-chloro-N-(1-pyrazin-2-ylpiperidin-4-yl)-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NC1CCN(c2cnccn2)CC1)c1cc(Cl)c[nH]1 |
| InChI | InChI=1S/C14H16ClN5O/c15-10-7-12(18-8-10)14(21)19-11-1-5-20(6-2-11)13-9-16-3-4-17-13/h3-4,7-9,11,18H,1-2,5-6H2,(H,19,21) |
| InChIKey | OHOQQADEPRDSGI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |