C15H20N6O3 — CID 125155070
(4R)-2,7-dioxo-N-(1-pyrazin-2-ylpiperidin-4-yl)-1,3-diazepane-4-carboxamide (PubChem CID 125155070) has the molecular formula C15H20N6O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is (4R)-2,7-dioxo-N-(1-pyrazin-2-ylpiperidin-4-yl)-1,3-diazepane-4-carboxamide.
| Compound Name | (4R)-2,7-dioxo-N-(1-pyrazin-2-ylpiperidin-4-yl)-1,3-diazepane-4-carboxamide |
|---|---|
| PubChem CID | 125155070 |
| Molecular Formula | C15H20N6O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | (4R)-2,7-dioxo-N-(1-pyrazin-2-ylpiperidin-4-yl)-1,3-diazepane-4-carboxamide |
| SMILES | O=C1CC[C@H](C(=O)NC2CCN(c3cnccn3)CC2)NC(=O)N1 |
| InChI | InChI=1S/C15H20N6O3/c22-13-2-1-11(19-15(24)20-13)14(23)18-10-3-7-21(8-4-10)12-9-16-5-6-17-12/h5-6,9-11H,1-4,7-8H2,(H,18,23)(H2,19,20,22,24)/t11-/m1/s1 |
| InChIKey | ASSZPGVCLBGOFK-LLVKDONJSA-N |
| XLogP | -0.45 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |