C18H27N5O2 — CID 97125874
(3R)-1-tert-butyl-5-oxo-N-(1-pyrazin-2-ylpiperidin-4-yl)pyrrolidine-3-carboxamide (PubChem CID 97125874) has the molecular formula C18H27N5O2 and a molecular weight of 345.45 g/mol. Its IUPAC name is (3R)-1-tert-butyl-5-oxo-N-(1-pyrazin-2-ylpiperidin-4-yl)pyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-tert-butyl-5-oxo-N-(1-pyrazin-2-ylpiperidin-4-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 97125874 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | (3R)-1-tert-butyl-5-oxo-N-(1-pyrazin-2-ylpiperidin-4-yl)pyrrolidine-3-carboxamide |
| SMILES | CC(C)(C)N1C[C@H](C(=O)NC2CCN(c3cnccn3)CC2)CC1=O |
| InChI | InChI=1S/C18H27N5O2/c1-18(2,3)23-12-13(10-16(23)24)17(25)21-14-4-8-22(9-5-14)15-11-19-6-7-20-15/h6-7,11,13-14H,4-5,8-10,12H2,1-3H3,(H,21,25)/t13-/m1/s1 |
| InChIKey | OGYXPJCXIBVIEN-CYBMUJFWSA-N |
| XLogP | 1.21 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |