C16H20F3N5 — CID 172904932
4-[[3-(difluoromethyl)-1-methylpyrazol-4-yl]methyl]-1-(6-fluoro-2-pyridinyl)-2-methylpiperazine (PubChem CID 172904932) has the molecular formula C16H20F3N5 and a molecular weight of 339.37 g/mol. Its IUPAC name is 4-[[3-(difluoromethyl)-1-methylpyrazol-4-yl]methyl]-1-(6-fluoro-2-pyridinyl)-2-methylpiperazine.
| Compound Name | 4-[[3-(difluoromethyl)-1-methylpyrazol-4-yl]methyl]-1-(6-fluoro-2-pyridinyl)-2-methylpiperazine |
|---|---|
| PubChem CID | 172904932 |
| Molecular Formula | C16H20F3N5 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 4-[[3-(difluoromethyl)-1-methylpyrazol-4-yl]methyl]-1-(6-fluoro-2-pyridinyl)-2-methylpiperazine |
| SMILES | CC1CN(Cc2cn(C)nc2C(F)F)CCN1c1cccc(F)n1 |
| InChI | InChI=1S/C16H20F3N5/c1-11-8-23(10-12-9-22(2)21-15(12)16(18)19)6-7-24(11)14-5-3-4-13(17)20-14/h3-5,9,11,16H,6-8,10H2,1-2H3 |
| InChIKey | FTOJECQWZMETMJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|