C15H24N2 — CID 172907234
1-cyclopenta-2,4-dien-1-yl-4-piperidin-1-ylpiperidine (PubChem CID 172907234) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-yl-4-piperidin-1-ylpiperidine.
| Compound Name | 1-cyclopenta-2,4-dien-1-yl-4-piperidin-1-ylpiperidine |
|---|---|
| PubChem CID | 172907234 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-yl-4-piperidin-1-ylpiperidine |
| SMILES | C1=CC(N2CCC(N3CCCCC3)CC2)C=C1 |
| InChI | InChI=1S/C15H24N2/c1-4-10-16(11-5-1)15-8-12-17(13-9-15)14-6-2-3-7-14/h2-3,6-7,14-15H,1,4-5,8-13H2 |
| InChIKey | FDNHDIRRIWIYQF-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |