C18H19N3O6S — CID 172910584
formic acid;6-[3-(1H-imidazol-2-yl)piperidin-1-yl]sulfonylchromen-2-one (PubChem CID 172910584) has the molecular formula C18H19N3O6S and a molecular weight of 405.43 g/mol. Its IUPAC name is formic acid;6-[3-(1H-imidazol-2-yl)piperidin-1-yl]sulfonylchromen-2-one.
| Compound Name | formic acid;6-[3-(1H-imidazol-2-yl)piperidin-1-yl]sulfonylchromen-2-one |
|---|---|
| PubChem CID | 172910584 |
| Molecular Formula | C18H19N3O6S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | formic acid;6-[3-(1H-imidazol-2-yl)piperidin-1-yl]sulfonylchromen-2-one |
| SMILES | O=CO.O=c1ccc2cc(S(=O)(=O)N3CCCC(c4ncc[nH]4)C3)ccc2o1 |
| InChI | InChI=1S/C17H17N3O4S.CH2O2/c21-16-6-3-12-10-14(4-5-15(12)24-16)25(22,23)20-9-1-2-13(11-20)17-18-7-8-19-17;2-1-3/h3-8,10,13H,1-2,9,11H2,(H,18,19);1H,(H,2,3) |
| InChIKey | JMWHVWPLRZMIFO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 133.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|