C19H29FN4O2 — CID 172913026
N,N-diethyl-2-[4-(6-fluoro-1H-benzimidazol-2-yl)piperidin-1-yl]ethanamine;formic acid (PubChem CID 172913026) has the molecular formula C19H29FN4O2 and a molecular weight of 364.47 g/mol. Its IUPAC name is N,N-diethyl-2-[4-(6-fluoro-1H-benzimidazol-2-yl)piperidin-1-yl]ethanamine;formic acid.
| Compound Name | N,N-diethyl-2-[4-(6-fluoro-1H-benzimidazol-2-yl)piperidin-1-yl]ethanamine;formic acid |
|---|---|
| PubChem CID | 172913026 |
| Molecular Formula | C19H29FN4O2 |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | N,N-diethyl-2-[4-(6-fluoro-1H-benzimidazol-2-yl)piperidin-1-yl]ethanamine;formic acid |
| SMILES | CCN(CC)CCN1CCC(c2nc3ccc(F)cc3[nH]2)CC1.O=CO |
| InChI | InChI=1S/C18H27FN4.CH2O2/c1-3-22(4-2)11-12-23-9-7-14(8-10-23)18-20-16-6-5-15(19)13-17(16)21-18;2-1-3/h5-6,13-14H,3-4,7-12H2,1-2H3,(H,20,21);1H,(H,2,3) |
| InChIKey | WMIKBYSXQHKVGA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 72.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|