C16H9BrF2N4O4 — CID 172917695
5-bromo-3-[(E)-[2-(difluoromethoxy)-5-nitrophenyl]methylidenehydrazinylidene]-1H-indol-2-one (PubChem CID 172917695) has the molecular formula C16H9BrF2N4O4 and a molecular weight of 439.17 g/mol. Its IUPAC name is 5-bromo-3-[(E)-[2-(difluoromethoxy)-5-nitrophenyl]methylidenehydrazinylidene]-1H-indol-2-one.
| Compound Name | 5-bromo-3-[(E)-[2-(difluoromethoxy)-5-nitrophenyl]methylidenehydrazinylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 172917695 |
| Molecular Formula | C16H9BrF2N4O4 |
| Molecular Weight | 439.17 g/mol |
| Exact Mass | 437.98 |
| IUPAC Name | 5-bromo-3-[(E)-[2-(difluoromethoxy)-5-nitrophenyl]methylidenehydrazinylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(Br)cc2C1=N/N=C/c1cc([N+](=O)[O-])ccc1OC(F)F |
| InChI | InChI=1S/C16H9BrF2N4O4/c17-9-1-3-12-11(6-9)14(15(24)21-12)22-20-7-8-5-10(23(25)26)2-4-13(8)27-16(18)19/h1-7,16H,(H,21,22,24)/b20-7+ |
| InChIKey | CHKNQBLRDMXISP-IFRROFPPSA-N |
| XLogP | 3.73 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.17 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|