C20H17F2N5O5 — CID 172921073
2-fluoro-6-[[[(2E)-2-methoxyiminoethylidene]amino]methyl]benzoic acid;2-fluoro-6-(triazol-2-yl)benzoic acid (PubChem CID 172921073) has the molecular formula C20H17F2N5O5 and a molecular weight of 445.38 g/mol. Its IUPAC name is 2-fluoro-6-[[[(2E)-2-methoxyiminoethylidene]amino]methyl]benzoic acid;2-fluoro-6-(triazol-2-yl)benzoic acid.
| Compound Name | 2-fluoro-6-[[[(2E)-2-methoxyiminoethylidene]amino]methyl]benzoic acid;2-fluoro-6-(triazol-2-yl)benzoic acid |
|---|---|
| PubChem CID | 172921073 |
| Molecular Formula | C20H17F2N5O5 |
| Molecular Weight | 445.38 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 2-fluoro-6-[[[(2E)-2-methoxyiminoethylidene]amino]methyl]benzoic acid;2-fluoro-6-(triazol-2-yl)benzoic acid |
| SMILES | CO/N=C/C=N/Cc1cccc(F)c1C(=O)O.O=C(O)c1c(F)cccc1-n1nccn1 |
| InChI | InChI=1S/C11H11FN2O3.C9H6FN3O2/c1-17-14-6-5-13-7-8-3-2-4-9(12)10(8)11(15)16;10-6-2-1-3-7(8(6)9(14)15)13-11-4-5-12-13/h2-6H,7H2,1H3,(H,15,16);1-5H,(H,14,15)/b13-5+,14-6+; |
| InChIKey | WTAJWRCTTDGHPP-HGYMEXNASA-N |
| XLogP | 2.83 |
| TPSA | 139.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|