C10H9FO2 — CID 162681590
2-(3,3-dideuterioprop-2-enyl)-6-fluorobenzoic acid (PubChem CID 162681590) has the molecular formula C10H9FO2 and a molecular weight of 182.19 g/mol. Its IUPAC name is 2-(3,3-dideuterioprop-2-enyl)-6-fluorobenzoic acid.
| Compound Name | 2-(3,3-dideuterioprop-2-enyl)-6-fluorobenzoic acid |
|---|---|
| PubChem CID | 162681590 |
| Molecular Formula | C10H9FO2 |
| Molecular Weight | 182.19 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 2-(3,3-dideuterioprop-2-enyl)-6-fluorobenzoic acid |
| SMILES | [2H]C([2H])=CCc1cccc(F)c1C(=O)O |
| InChI | InChI=1S/C10H9FO2/c1-2-4-7-5-3-6-8(11)9(7)10(12)13/h2-3,5-6H,1,4H2,(H,12,13)/i1D2 |
| InChIKey | AQINHXDPJVUFMP-DICFDUPASA-N |
| XLogP | 2.25 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.19 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|