C25H34BN7O7S2 — CID 172921115
CID 172921115 (PubChem CID 172921115) has the molecular formula C25H34BN7O7S2 and a molecular weight of 619.54 g/mol.
| Compound Name | CID 172921115 |
|---|---|
| PubChem CID | 172921115 |
| Molecular Formula | C25H34BN7O7S2 |
| Molecular Weight | 619.54 g/mol |
| Exact Mass | 619.21 |
| IUPAC Name | — |
| SMILES | [B]OC(=O)[C@@]1(N2C[C@@H](C)N(N)C2=O)CN2C(=O)[C@@H](CC(=O)/C(=N\OC(C)(C)C(=O)CCCCC)c3csc(N)n3)[C@H]2S1 |
| InChI | InChI=1S/C25H34BN7O7S2/c1-5-6-7-8-17(35)24(3,4)40-30-18(15-11-41-22(27)29-15)16(34)9-14-19(36)31-12-25(21(37)39-26,42-20(14)31)32-10-13(2)33(28)23(32)38/h11,13-14,20H,5-10,12,28H2,1-4H3,(H2,27,29)/b30-18-/t13-,14-,20-,25-/m1/s1 |
| InChIKey | VIYYMKFOCJEQQN-VYGBVHBMSA-N |
| XLogP | 1.19 |
| TPSA | 190.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.54 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|