C28H28B2N6O8S2 — CID 172928104
CID 172928104 (PubChem CID 172928104) has the molecular formula C28H28B2N6O8S2 and a molecular weight of 662.32 g/mol.
| Compound Name | CID 172928104 |
|---|---|
| PubChem CID | 172928104 |
| Molecular Formula | C28H28B2N6O8S2 |
| Molecular Weight | 662.32 g/mol |
| Exact Mass | 662.16 |
| IUPAC Name | — |
| SMILES | [B]OC(=O)[C@@H](CC)O/N=C(\C(=O)C[C@@H]1C(=O)N2CC(C(=O)O[B])(N3CCN(/N=C/c4ccc(C)cc4)C3=O)S[C@H]12)c1csc(C)n1 |
| InChI | InChI=1S/C28H28B2N6O8S2/c1-4-21(25(39)42-29)44-33-22(19-13-45-16(3)32-19)20(37)11-18-23(38)34-14-28(26(40)43-30,46-24(18)34)35-9-10-36(27(35)41)31-12-17-7-5-15(2)6-8-17/h5-8,12-13,18,21,24H,4,9-11,14H2,1-3H3/b31-12+,33-22-/t18-,21-,24-,28?/m1/s1 |
| InChIKey | XNXCAVZUQITSPO-SHMLQJTFSA-N |
| XLogP | 1.47 |
| TPSA | 160.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|