About CID 172954197
CID 172954197 (PubChem CID 172954197) has the molecular formula C21H21B2ClN6O8S2
and a molecular weight of 606.64 g/mol.
Molecular Properties
| Compound Name | CID 172954197 |
| PubChem CID | 172954197 |
| Molecular Formula | C21H21B2ClN6O8S2 |
| Molecular Weight | 606.64 g/mol |
| Exact Mass | 606.07 |
| IUPAC Name | — |
| SMILES | [B]OC(=O)C1(O/N=C(\C(=O)CC2C(=O)N3C[C@@](C(=O)O[B])(N4CCN(N)C4=O)S[C@H]23)c2nc(C)sc2Cl)CCC1 |
| InChI | InChI=1S/C21H21B2ClN6O8S2/c1-9-26-13(14(24)39-9)12(27-38-20(3-2-4-20)17(33)36-22)11(31)7-10-15(32)28-8-21(18(34)37-23,40-16(10)28)29-5-6-30(25)19(29)35/h10,16H,2-8,25H2,1H3/b27-12+/t10?,16-,21-/m1/s1 |
| InChIKey | YJJNIJXLZZHCIZ-KUJHBZRCSA-N |
| XLogP | -0.20 |
| TPSA | 174.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 606.64 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 172954197 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172954197?
The IUPAC name of CID 172954197 (CID 172954197) is not available.
What is the SMILES notation for CID 172954197?
The canonical SMILES for CID 172954197 is [B]OC(=O)C1(O/N=C(\C(=O)CC2C(=O)N3C[C@@](C(=O)O[B])(N4CCN(N)C4=O)S[C@H]23)c2nc(C)sc2Cl)CCC1.
What is the InChIKey of CID 172954197?
The InChIKey is YJJNIJXLZZHCIZ-KUJHBZRCSA-N. The full InChI is InChI=1S/C21H21B2ClN6O8S2/c1-9-26-13(14(24)39-9)12(27-38-20(3-2-4-20)17(33)36-22)11(31)7-10-15(32)28-8-21(18(34)37-23,40-16(10)28)29-5-6-30(25)19(29)35/h10,16H,2-8,25H2,1H3/b27-12+/t10?,16-,21-/m1/s1.
What are the key properties of CID 172954197?
CID 172954197 has a molecular weight of 606.64 g/mol, XLogP of -0.20, 9 rotatable bonds, 1 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172954197 is sourced from PubChem (CID 172954197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).