C22H27BN6O8S2 — CID 172974876
CID 172974876 (PubChem CID 172974876) has the molecular formula C22H27BN6O8S2 and a molecular weight of 578.44 g/mol.
| Compound Name | CID 172974876 |
|---|---|
| PubChem CID | 172974876 |
| Molecular Formula | C22H27BN6O8S2 |
| Molecular Weight | 578.44 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | — |
| SMILES | [B]OC(=O)[C@@]1(N2CCN(N)C2=O)CN2C(=O)C(CC(=O)/C(=N\OCC(=O)OC(C)(C)C)c3csc(C)n3)[C@H]2S1 |
| InChI | InChI=1S/C22H27BN6O8S2/c1-11-25-13(9-38-11)16(26-35-8-15(31)36-21(2,3)4)14(30)7-12-17(32)27-10-22(19(33)37-23,39-18(12)27)28-5-6-29(24)20(28)34/h9,12,18H,5-8,10,24H2,1-4H3/b26-16-/t12?,18-,22-/m1/s1 |
| InChIKey | JEHGNVKSLNNDFO-OWRXQCKNSA-N |
| XLogP | -0.06 |
| TPSA | 174.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.44 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|