C44H41B2ClN6O12S2 — CID 172949742
CID 172949742 (PubChem CID 172949742) has the molecular formula C44H41B2ClN6O12S2 and a molecular weight of 967.05 g/mol.
| Compound Name | CID 172949742 |
|---|---|
| PubChem CID | 172949742 |
| Molecular Formula | C44H41B2ClN6O12S2 |
| Molecular Weight | 967.05 g/mol |
| Exact Mass | 966.21 |
| IUPAC Name | — |
| SMILES | [B]OC(=O)C1(O/N=C(\C(=O)CC2C(=O)N3C[C@@](C(=O)O[B])(N4CCN(/N=C/c5ccc(OCc6ccc(OC)cc6)c(OCc6ccc(OC)cc6)c5Cl)C4=O)S[C@H]23)c2csc(C)n2)CCC1 |
| InChI | InChI=1S/C44H41B2ClN6O12S2/c1-25-49-32(23-66-25)36(50-65-43(15-4-16-43)40(56)63-45)33(54)19-31-38(55)51-24-44(41(57)64-46,67-39(31)51)52-17-18-53(42(52)58)48-20-28-9-14-34(61-21-26-5-10-29(59-2)11-6-26)37(35(28)47)62-22-27-7-12-30(60-3)13-8-27/h5-14,20,23,31,39H,4,15-19,21-22,24H2,1-3H3/b48-20+,50-36-/t31?,39-,44-/m1/s1 |
| InChIKey | AAISVIXSZFAHHH-YFLDAIOLSA-N |
| XLogP | 5.14 |
| TPSA | 197.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 967.05 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|