C30H30I2N2O7 — CID 172922549
[(Z)-1-[4-[4-[1-(acetyloxy-λ3-iodanylidene)ethyl]-N-[4-[1-(acetyloxy-λ3-iodanylidene)ethyl]-3-hydroxyphenyl]anilino]phenyl]ethylideneamino] acetate (PubChem CID 172922549) has the molecular formula C30H30I2N2O7 and a molecular weight of 784.38 g/mol. Its IUPAC name is [(Z)-1-[4-[4-[1-(acetyloxy-λ3-iodanylidene)ethyl]-N-[4-[1-(acetyloxy-λ3-iodanylidene)ethyl]-3-hydroxyphenyl]anilino]phenyl]ethylideneamino] acetate.
| Compound Name | [(Z)-1-[4-[4-[1-(acetyloxy-λ3-iodanylidene)ethyl]-N-[4-[1-(acetyloxy-λ3-iodanylidene)ethyl]-3-hydroxyphenyl]anilino]phenyl]ethylideneamino] acetate |
|---|---|
| PubChem CID | 172922549 |
| Molecular Formula | C30H30I2N2O7 |
| Molecular Weight | 784.38 g/mol |
| Exact Mass | 784.01 |
| IUPAC Name | [(Z)-1-[4-[4-[1-(acetyloxy-λ3-iodanylidene)ethyl]-N-[4-[1-(acetyloxy-λ3-iodanylidene)ethyl]-3-hydroxyphenyl]anilino]phenyl]ethylideneamino] acetate |
| SMILES | CC(=O)O/N=C(/C)c1ccc(N(c2ccc(/C(C)=I/OC(C)=O)cc2)c2ccc(/C(C)=I/OC(C)=O)c(O)c2)cc1 |
| InChI | InChI=1S/C30H30I2N2O7/c1-18(31-39-21(4)35)24-7-11-26(12-8-24)34(27-13-9-25(10-14-27)20(3)33-41-23(6)37)28-15-16-29(30(38)17-28)19(2)32-40-22(5)36/h7-17,38H,1-6H3/b33-20- |
| InChIKey | CMMWSCQRSMEPIT-UCMJSZAQSA-N |
| XLogP | 7.13 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.38 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|