C28H25N3O5S — CID 145264461
[(E)-1-[2-(N-[4-[(Z)-N-acetyloxy-C-methylcarbonimidoyl]-3-hydroxyphenyl]anilino)-1-benzothiophen-6-yl]ethylideneamino] acetate (PubChem CID 145264461) has the molecular formula C28H25N3O5S and a molecular weight of 515.59 g/mol. Its IUPAC name is [(E)-1-[2-(N-[4-[(Z)-N-acetyloxy-C-methylcarbonimidoyl]-3-hydroxyphenyl]anilino)-1-benzothiophen-6-yl]ethylideneamino] acetate.
| Compound Name | [(E)-1-[2-(N-[4-[(Z)-N-acetyloxy-C-methylcarbonimidoyl]-3-hydroxyphenyl]anilino)-1-benzothiophen-6-yl]ethylideneamino] acetate |
|---|---|
| PubChem CID | 145264461 |
| Molecular Formula | C28H25N3O5S |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | [(E)-1-[2-(N-[4-[(Z)-N-acetyloxy-C-methylcarbonimidoyl]-3-hydroxyphenyl]anilino)-1-benzothiophen-6-yl]ethylideneamino] acetate |
| SMILES | CC(=O)O/N=C(/C)c1ccc(N(c2ccccc2)c2cc3ccc(/C(C)=N/OC(C)=O)cc3s2)cc1O |
| InChI | InChI=1S/C28H25N3O5S/c1-17(29-35-19(3)32)21-10-11-22-15-28(37-27(22)14-21)31(23-8-6-5-7-9-23)24-12-13-25(26(34)16-24)18(2)30-36-20(4)33/h5-16,34H,1-4H3/b29-17+,30-18- |
| InChIKey | KFJCTLFWZAQSOL-AFVORURQSA-N |
| XLogP | 6.65 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|