C38H33N3O5 — CID 145264431
[(Z)-1-[4-[3-[(Z)-N-acetyloxy-C-methylcarbonimidoyl]-N-[6-(2-phenylacetyl)naphthalen-1-yl]anilino]phenyl]ethylideneamino] acetate (PubChem CID 145264431) has the molecular formula C38H33N3O5 and a molecular weight of 611.70 g/mol. Its IUPAC name is [(Z)-1-[4-[3-[(Z)-N-acetyloxy-C-methylcarbonimidoyl]-N-[6-(2-phenylacetyl)naphthalen-1-yl]anilino]phenyl]ethylideneamino] acetate.
| Compound Name | [(Z)-1-[4-[3-[(Z)-N-acetyloxy-C-methylcarbonimidoyl]-N-[6-(2-phenylacetyl)naphthalen-1-yl]anilino]phenyl]ethylideneamino] acetate |
|---|---|
| PubChem CID | 145264431 |
| Molecular Formula | C38H33N3O5 |
| Molecular Weight | 611.70 g/mol |
| Exact Mass | 611.24 |
| IUPAC Name | [(Z)-1-[4-[3-[(Z)-N-acetyloxy-C-methylcarbonimidoyl]-N-[6-(2-phenylacetyl)naphthalen-1-yl]anilino]phenyl]ethylideneamino] acetate |
| SMILES | CC(=O)O/N=C(/C)c1ccc(N(c2cccc(/C(C)=N\OC(C)=O)c2)c2cccc3cc(C(=O)Cc4ccccc4)ccc23)cc1 |
| InChI | InChI=1S/C38H33N3O5/c1-25(39-45-27(3)42)30-16-19-34(20-17-30)41(35-14-8-12-31(24-35)26(2)40-46-28(4)43)37-15-9-13-32-23-33(18-21-36(32)37)38(44)22-29-10-6-5-7-11-29/h5-21,23-24H,22H2,1-4H3/b39-25-,40-26- |
| InChIKey | PZYCJHZPTLPSQR-QASZCPKBSA-N |
| XLogP | 8.31 |
| TPSA | 97.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.70 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|