C48H45N3O4S — CID 145264445
[(Z)-[[4-[5-[(Z)-N-acetyloxy-C-phenylcarbonimidoyl]-2-(2-cyclohexylethylsulfanyl)-N-naphthalen-1-ylanilino]phenyl]-phenylmethylidene]amino] acetate (PubChem CID 145264445) has the molecular formula C48H45N3O4S and a molecular weight of 759.97 g/mol. Its IUPAC name is [(Z)-[[4-[5-[(Z)-N-acetyloxy-C-phenylcarbonimidoyl]-2-(2-cyclohexylethylsulfanyl)-N-naphthalen-1-ylanilino]phenyl]-phenylmethylidene]amino] acetate.
| Compound Name | [(Z)-[[4-[5-[(Z)-N-acetyloxy-C-phenylcarbonimidoyl]-2-(2-cyclohexylethylsulfanyl)-N-naphthalen-1-ylanilino]phenyl]-phenylmethylidene]amino] acetate |
|---|---|
| PubChem CID | 145264445 |
| Molecular Formula | C48H45N3O4S |
| Molecular Weight | 759.97 g/mol |
| Exact Mass | 759.31 |
| IUPAC Name | [(Z)-[[4-[5-[(Z)-N-acetyloxy-C-phenylcarbonimidoyl]-2-(2-cyclohexylethylsulfanyl)-N-naphthalen-1-ylanilino]phenyl]-phenylmethylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(/c1ccccc1)c1ccc(N(c2cc(/C(=N\OC(C)=O)c3ccccc3)ccc2SCCC2CCCCC2)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C48H45N3O4S/c1-34(52)54-49-47(38-18-8-4-9-19-38)40-25-28-42(29-26-40)51(44-24-14-22-37-17-12-13-23-43(37)44)45-33-41(48(50-55-35(2)53)39-20-10-5-11-21-39)27-30-46(45)56-32-31-36-15-6-3-7-16-36/h4-5,8-14,17-30,33,36H,3,6-7,15-16,31-32H2,1-2H3/b49-47-,50-48- |
| InChIKey | RGYHHKSBADHRAV-ZLUQSPMJSA-N |
| XLogP | 12.00 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.97 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|