C38H36N2O5 — CID 145264375
[(E)-[1-[4-[4-(cyclohexanecarbonyl)-N-[3-(2-methylprop-2-enoyl)naphthalen-1-yl]anilino]phenyl]-1-oxopropan-2-ylidene]amino] acetate (PubChem CID 145264375) has the molecular formula C38H36N2O5 and a molecular weight of 600.71 g/mol. Its IUPAC name is [(E)-[1-[4-[4-(cyclohexanecarbonyl)-N-[3-(2-methylprop-2-enoyl)naphthalen-1-yl]anilino]phenyl]-1-oxopropan-2-ylidene]amino] acetate.
| Compound Name | [(E)-[1-[4-[4-(cyclohexanecarbonyl)-N-[3-(2-methylprop-2-enoyl)naphthalen-1-yl]anilino]phenyl]-1-oxopropan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 145264375 |
| Molecular Formula | C38H36N2O5 |
| Molecular Weight | 600.71 g/mol |
| Exact Mass | 600.26 |
| IUPAC Name | [(E)-[1-[4-[4-(cyclohexanecarbonyl)-N-[3-(2-methylprop-2-enoyl)naphthalen-1-yl]anilino]phenyl]-1-oxopropan-2-ylidene]amino] acetate |
| SMILES | C=C(C)C(=O)c1cc(N(c2ccc(C(=O)/C(C)=N/OC(C)=O)cc2)c2ccc(C(=O)C3CCCCC3)cc2)c2ccccc2c1 |
| InChI | InChI=1S/C38H36N2O5/c1-24(2)36(42)31-22-30-12-8-9-13-34(30)35(23-31)40(32-18-14-28(15-19-32)37(43)25(3)39-45-26(4)41)33-20-16-29(17-21-33)38(44)27-10-6-5-7-11-27/h8-9,12-23,27H,1,5-7,10-11H2,2-4H3/b39-25+ |
| InChIKey | RGUWVDDZKRKOOV-SBWWSWLISA-N |
| XLogP | 8.95 |
| TPSA | 93.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.71 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|